C22H34N2O3 — CID 175642102
1-[5-(azepan-1-ylmethyl)-2-methoxyphenoxy]-3-(3,6-dihydro-2H-pyridin-1-yl)propan-2-ol (PubChem CID 175642102) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-[5-(azepan-1-ylmethyl)-2-methoxyphenoxy]-3-(3,6-dihydro-2H-pyridin-1-yl)propan-2-ol.
| Compound Name | 1-[5-(azepan-1-ylmethyl)-2-methoxyphenoxy]-3-(3,6-dihydro-2H-pyridin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 175642102 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 1-[5-(azepan-1-ylmethyl)-2-methoxyphenoxy]-3-(3,6-dihydro-2H-pyridin-1-yl)propan-2-ol |
| SMILES | COc1ccc(CN2CCCCCC2)cc1OCC(O)CN1CC=CCC1 |
| InChI | InChI=1S/C22H34N2O3/c1-26-21-10-9-19(16-23-11-5-2-3-6-12-23)15-22(21)27-18-20(25)17-24-13-7-4-8-14-24/h4,7,9-10,15,20,25H,2-3,5-6,8,11-14,16-18H2,1H3 |
| InChIKey | NYAJBZQRIVOKCI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|