C22H34N2O4 — CID 175644306
1-[5-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-methoxyphenoxy]-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propan-2-ol (PubChem CID 175644306) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is 1-[5-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-methoxyphenoxy]-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propan-2-ol.
| Compound Name | 1-[5-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-methoxyphenoxy]-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 175644306 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 1-[5-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-methoxyphenoxy]-3-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propan-2-ol |
| SMILES | COc1ccc(CN2CC=CCC2)cc1OCC(O)CN1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C22H34N2O4/c1-17-12-24(13-18(2)28-17)15-20(25)16-27-22-11-19(7-8-21(22)26-3)14-23-9-5-4-6-10-23/h4-5,7-8,11,17-18,20,25H,6,9-10,12-16H2,1-3H3/t17-,18+,20? |
| InChIKey | JDAFPGAHYJGLBB-UFRUDQCGSA-N |
| XLogP | 2.31 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|