C19H16ClNO3 — CID 175642212
2-[4-(3-chloro-4-methoxyphenyl)naphthalen-2-yl]oxyacetamide (PubChem CID 175642212) has the molecular formula C19H16ClNO3 and a molecular weight of 341.79 g/mol. Its IUPAC name is 2-[4-(3-chloro-4-methoxyphenyl)naphthalen-2-yl]oxyacetamide.
| Compound Name | 2-[4-(3-chloro-4-methoxyphenyl)naphthalen-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 175642212 |
| Molecular Formula | C19H16ClNO3 |
| Molecular Weight | 341.79 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-[4-(3-chloro-4-methoxyphenyl)naphthalen-2-yl]oxyacetamide |
| SMILES | COc1ccc(-c2cc(OCC(N)=O)cc3ccccc23)cc1Cl |
| InChI | InChI=1S/C19H16ClNO3/c1-23-18-7-6-13(9-17(18)20)16-10-14(24-11-19(21)22)8-12-4-2-3-5-15(12)16/h2-10H,11H2,1H3,(H2,21,22) |
| InChIKey | ABEILIYETWJWRR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |