C25H20N2O3 — CID 175642500
(3aS,6aS)-5-[6-(1-benzofuran-6-yl)naphthalene-2-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one (PubChem CID 175642500) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is (3aS,6aS)-5-[6-(1-benzofuran-6-yl)naphthalene-2-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one.
| Compound Name | (3aS,6aS)-5-[6-(1-benzofuran-6-yl)naphthalene-2-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
|---|---|
| PubChem CID | 175642500 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (3aS,6aS)-5-[6-(1-benzofuran-6-yl)naphthalene-2-carbonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
| SMILES | O=C1C[C@H]2CN(C(=O)c3ccc4cc(-c5ccc6ccoc6c5)ccc4c3)C[C@H]2N1 |
| InChI | InChI=1S/C25H20N2O3/c28-24-12-21-13-27(14-22(21)26-24)25(29)20-6-5-16-9-17(3-4-18(16)10-20)19-2-1-15-7-8-30-23(15)11-19/h1-11,21-22H,12-14H2,(H,26,28)/t21-,22+/m0/s1 |
| InChIKey | YURJVRRJCBMGRV-FCHUYYIVSA-N |
| XLogP | 4.21 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |