C24H27ClN2O4 — CID 175645349
3-[2-[(3aS,5R,6R,7aR)-5-(4-chloro-2-methylphenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]ethyl]-1,3-benzoxazol-2-one (PubChem CID 175645349) has the molecular formula C24H27ClN2O4 and a molecular weight of 442.94 g/mol. Its IUPAC name is 3-[2-[(3aS,5R,6R,7aR)-5-(4-chloro-2-methylphenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]ethyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[2-[(3aS,5R,6R,7aR)-5-(4-chloro-2-methylphenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]ethyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 175645349 |
| Molecular Formula | C24H27ClN2O4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 3-[2-[(3aS,5R,6R,7aR)-5-(4-chloro-2-methylphenoxy)-6-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]ethyl]-1,3-benzoxazol-2-one |
| SMILES | Cc1cc(Cl)ccc1O[C@@H]1C[C@@H]2CN(CCn3c(=O)oc4ccccc43)C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C24H27ClN2O4/c1-15-10-18(25)6-7-21(15)30-23-12-17-14-26(13-16(17)11-20(23)28)8-9-27-19-4-2-3-5-22(19)31-24(27)29/h2-7,10,16-17,20,23,28H,8-9,11-14H2,1H3/t16-,17+,20+,23+/m0/s1 |
| InChIKey | LIZGIJYMHVCDIA-PYDOFHOQSA-N |
| XLogP | 3.71 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |