C23H23NO3 — CID 175645819
[(2R)-2-(hydroxymethyl)morpholin-4-yl]-[5-(3-methylphenyl)naphthalen-2-yl]methanone (PubChem CID 175645819) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is [(2R)-2-(hydroxymethyl)morpholin-4-yl]-[5-(3-methylphenyl)naphthalen-2-yl]methanone.
| Compound Name | [(2R)-2-(hydroxymethyl)morpholin-4-yl]-[5-(3-methylphenyl)naphthalen-2-yl]methanone |
|---|---|
| PubChem CID | 175645819 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | [(2R)-2-(hydroxymethyl)morpholin-4-yl]-[5-(3-methylphenyl)naphthalen-2-yl]methanone |
| SMILES | Cc1cccc(-c2cccc3cc(C(=O)N4CCO[C@@H](CO)C4)ccc23)c1 |
| InChI | InChI=1S/C23H23NO3/c1-16-4-2-5-17(12-16)21-7-3-6-18-13-19(8-9-22(18)21)23(26)24-10-11-27-20(14-24)15-25/h2-9,12-13,20,25H,10-11,14-15H2,1H3/t20-/m1/s1 |
| InChIKey | SDCGQDFZCOCDND-HXUWFJFHSA-N |
| XLogP | 3.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |