C8H14FNO4S — CID 175646570
2-[(3-fluorocyclohexyl)sulfonylamino]acetic acid (PubChem CID 175646570) has the molecular formula C8H14FNO4S and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-[(3-fluorocyclohexyl)sulfonylamino]acetic acid.
| Compound Name | 2-[(3-fluorocyclohexyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 175646570 |
| Molecular Formula | C8H14FNO4S |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-[(3-fluorocyclohexyl)sulfonylamino]acetic acid |
| SMILES | O=C(O)CNS(=O)(=O)C1CCCC(F)C1 |
| InChI | InChI=1S/C8H14FNO4S/c9-6-2-1-3-7(4-6)15(13,14)10-5-8(11)12/h6-7,10H,1-5H2,(H,11,12) |
| InChIKey | PNFQSNKJHZRFNA-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |