C24H23BrO3 — CID 175647416
1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxy-2-[(4-methoxyphenyl)methyl]benzene (PubChem CID 175647416) has the molecular formula C24H23BrO3 and a molecular weight of 439.35 g/mol. Its IUPAC name is 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxy-2-[(4-methoxyphenyl)methyl]benzene.
| Compound Name | 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxy-2-[(4-methoxyphenyl)methyl]benzene |
|---|---|
| PubChem CID | 175647416 |
| Molecular Formula | C24H23BrO3 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxy-2-[(4-methoxyphenyl)methyl]benzene |
| SMILES | COc1ccc(Cc2c(/C=C/c3ccc(Br)cc3)cc(OC)cc2OC)cc1 |
| InChI | InChI=1S/C24H23BrO3/c1-26-21-12-7-18(8-13-21)14-23-19(15-22(27-2)16-24(23)28-3)9-4-17-5-10-20(25)11-6-17/h4-13,15-16H,14H2,1-3H3/b9-4+ |
| InChIKey | FRMCTYZSFREOAL-RUDMXATFSA-N |
| XLogP | 6.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|