C20H23Cl2N3O2 — CID 175654669
3-chloro-1-[3-[3-(2-chlorophenoxy)pyrazin-2-yl]piperidin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 175654669) has the molecular formula C20H23Cl2N3O2 and a molecular weight of 408.33 g/mol. Its IUPAC name is 3-chloro-1-[3-[3-(2-chlorophenoxy)pyrazin-2-yl]piperidin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 3-chloro-1-[3-[3-(2-chlorophenoxy)pyrazin-2-yl]piperidin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 175654669 |
| Molecular Formula | C20H23Cl2N3O2 |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-chloro-1-[3-[3-(2-chlorophenoxy)pyrazin-2-yl]piperidin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(CCl)C(=O)N1CCCC(c2nccnc2Oc2ccccc2Cl)C1 |
| InChI | InChI=1S/C20H23Cl2N3O2/c1-20(2,13-21)19(26)25-11-5-6-14(12-25)17-18(24-10-9-23-17)27-16-8-4-3-7-15(16)22/h3-4,7-10,14H,5-6,11-13H2,1-2H3 |
| InChIKey | VYAXPXNOESUWTB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|