C29H29F3N4O4 — CID 175654985
3-[2-methyl-4-oxo-6-[2-[1-[3-(trifluoromethyl)benzoyl]piperidin-4-yl]ethyl]quinazolin-3-yl]piperidine-2,6-dione (PubChem CID 175654985) has the molecular formula C29H29F3N4O4 and a molecular weight of 554.57 g/mol. Its IUPAC name is 3-[2-methyl-4-oxo-6-[2-[1-[3-(trifluoromethyl)benzoyl]piperidin-4-yl]ethyl]quinazolin-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[2-methyl-4-oxo-6-[2-[1-[3-(trifluoromethyl)benzoyl]piperidin-4-yl]ethyl]quinazolin-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175654985 |
| Molecular Formula | C29H29F3N4O4 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 3-[2-methyl-4-oxo-6-[2-[1-[3-(trifluoromethyl)benzoyl]piperidin-4-yl]ethyl]quinazolin-3-yl]piperidine-2,6-dione |
| SMILES | Cc1nc2ccc(CCC3CCN(C(=O)c4cccc(C(F)(F)F)c4)CC3)cc2c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C29H29F3N4O4/c1-17-33-23-8-7-19(15-22(23)28(40)36(17)24-9-10-25(37)34-26(24)38)6-5-18-11-13-35(14-12-18)27(39)20-3-2-4-21(16-20)29(30,31)32/h2-4,7-8,15-16,18,24H,5-6,9-14H2,1H3,(H,34,37,38) |
| InChIKey | RAAURVKZWILOPE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|