C20H25F3N8O2 — CID 175655183
N-(2-methoxyethyl)-2-[4-[(2-methylpyrimidin-4-yl)methyl]morpholin-2-yl]-9-(2,2,2-trifluoroethyl)purin-6-amine (PubChem CID 175655183) has the molecular formula C20H25F3N8O2 and a molecular weight of 466.47 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[4-[(2-methylpyrimidin-4-yl)methyl]morpholin-2-yl]-9-(2,2,2-trifluoroethyl)purin-6-amine.
| Compound Name | N-(2-methoxyethyl)-2-[4-[(2-methylpyrimidin-4-yl)methyl]morpholin-2-yl]-9-(2,2,2-trifluoroethyl)purin-6-amine |
|---|---|
| PubChem CID | 175655183 |
| Molecular Formula | C20H25F3N8O2 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N-(2-methoxyethyl)-2-[4-[(2-methylpyrimidin-4-yl)methyl]morpholin-2-yl]-9-(2,2,2-trifluoroethyl)purin-6-amine |
| SMILES | COCCNc1nc(C2CN(Cc3ccnc(C)n3)CCO2)nc2c1ncn2CC(F)(F)F |
| InChI | InChI=1S/C20H25F3N8O2/c1-13-24-4-3-14(27-13)9-30-6-8-33-15(10-30)17-28-18(25-5-7-32-2)16-19(29-17)31(12-26-16)11-20(21,22)23/h3-4,12,15H,5-11H2,1-2H3,(H,25,28,29) |
| InChIKey | LVJYKEXAZNADST-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|