C20H29NO6 — CID 175659628
methyl 5-[3-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]phenyl]-3-oxopentanoate (PubChem CID 175659628) has the molecular formula C20H29NO6 and a molecular weight of 379.45 g/mol. Its IUPAC name is methyl 5-[3-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]phenyl]-3-oxopentanoate.
| Compound Name | methyl 5-[3-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]phenyl]-3-oxopentanoate |
|---|---|
| PubChem CID | 175659628 |
| Molecular Formula | C20H29NO6 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | methyl 5-[3-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethoxy]phenyl]-3-oxopentanoate |
| SMILES | COC(=O)CC(=O)CCc1cccc(OCCN(C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C20H29NO6/c1-20(2,3)27-19(24)21(4)11-12-26-17-8-6-7-15(13-17)9-10-16(22)14-18(23)25-5/h6-8,13H,9-12,14H2,1-5H3 |
| InChIKey | VZJAUKBHTANUTF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|