C16H16F3N3O — CID 175661292
2-piperidin-3-yl-3-[4-(trifluoromethyl)phenoxy]pyrazine (PubChem CID 175661292) has the molecular formula C16H16F3N3O and a molecular weight of 323.32 g/mol. Its IUPAC name is 2-piperidin-3-yl-3-[4-(trifluoromethyl)phenoxy]pyrazine.
| Compound Name | 2-piperidin-3-yl-3-[4-(trifluoromethyl)phenoxy]pyrazine |
|---|---|
| PubChem CID | 175661292 |
| Molecular Formula | C16H16F3N3O |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-piperidin-3-yl-3-[4-(trifluoromethyl)phenoxy]pyrazine |
| SMILES | FC(F)(F)c1ccc(Oc2nccnc2C2CCCNC2)cc1 |
| InChI | InChI=1S/C16H16F3N3O/c17-16(18,19)12-3-5-13(6-4-12)23-15-14(21-8-9-22-15)11-2-1-7-20-10-11/h3-6,8-9,11,20H,1-2,7,10H2 |
| InChIKey | HUWFTOXBFVXDRL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |