C23H36N4O3 — CID 175662274
tert-butyl 2-oxospiro[3,9,17-triazabicyclo[11.3.1]heptadeca-1(16),13(17),14-triene-5,4'-piperidine]-1'-carboxylate (PubChem CID 175662274) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is tert-butyl 2-oxospiro[3,9,17-triazabicyclo[11.3.1]heptadeca-1(16),13(17),14-triene-5,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 2-oxospiro[3,9,17-triazabicyclo[11.3.1]heptadeca-1(16),13(17),14-triene-5,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 175662274 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | tert-butyl 2-oxospiro[3,9,17-triazabicyclo[11.3.1]heptadeca-1(16),13(17),14-triene-5,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCNCCCc3cccc(n3)C(=O)NC2)CC1 |
| InChI | InChI=1S/C23H36N4O3/c1-22(2,3)30-21(29)27-15-11-23(12-16-27)10-6-14-24-13-5-8-18-7-4-9-19(26-18)20(28)25-17-23/h4,7,9,24H,5-6,8,10-17H2,1-3H3,(H,25,28) |
| InChIKey | APLUGWUUCLWBHC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |