C31H44N4O4 — CID 175660159
tert-butyl 19-methyl-20-oxospiro[8-oxa-13,19,23-triazatricyclo[19.3.1.02,7]pentacosa-1(25),2,4,6,21,23-hexaene-17,4'-piperidine]-1'-carboxylate (PubChem CID 175660159) has the molecular formula C31H44N4O4 and a molecular weight of 536.72 g/mol. Its IUPAC name is tert-butyl 19-methyl-20-oxospiro[8-oxa-13,19,23-triazatricyclo[19.3.1.02,7]pentacosa-1(25),2,4,6,21,23-hexaene-17,4'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 19-methyl-20-oxospiro[8-oxa-13,19,23-triazatricyclo[19.3.1.02,7]pentacosa-1(25),2,4,6,21,23-hexaene-17,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 175660159 |
| Molecular Formula | C31H44N4O4 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | tert-butyl 19-methyl-20-oxospiro[8-oxa-13,19,23-triazatricyclo[19.3.1.02,7]pentacosa-1(25),2,4,6,21,23-hexaene-17,4'-piperidine]-1'-carboxylate |
| SMILES | CN1CC2(CCCNCCCCOc3ccccc3-c3cncc(c3)C1=O)CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C31H44N4O4/c1-30(2,3)39-29(37)35-17-13-31(14-18-35)12-9-16-32-15-7-8-19-38-27-11-6-5-10-26(27)24-20-25(22-33-21-24)28(36)34(4)23-31/h5-6,10-11,20-22,32H,7-9,12-19,23H2,1-4H3 |
| InChIKey | UBZXNCFHAOXICU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |