C27H42N4O5 — CID 175661022
tert-butyl 4-(10-methyl-11,15-dioxo-2-oxa-6,10,14-triazabicyclo[14.4.0]icosa-1(20),16,18-trien-13-yl)piperidine-1-carboxylate (PubChem CID 175661022) has the molecular formula C27H42N4O5 and a molecular weight of 502.66 g/mol. Its IUPAC name is tert-butyl 4-(10-methyl-11,15-dioxo-2-oxa-6,10,14-triazabicyclo[14.4.0]icosa-1(20),16,18-trien-13-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(10-methyl-11,15-dioxo-2-oxa-6,10,14-triazabicyclo[14.4.0]icosa-1(20),16,18-trien-13-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175661022 |
| Molecular Formula | C27H42N4O5 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | tert-butyl 4-(10-methyl-11,15-dioxo-2-oxa-6,10,14-triazabicyclo[14.4.0]icosa-1(20),16,18-trien-13-yl)piperidine-1-carboxylate |
| SMILES | CN1CCCNCCCOc2ccccc2C(=O)NC(C2CCN(C(=O)OC(C)(C)C)CC2)CC1=O |
| InChI | InChI=1S/C27H42N4O5/c1-27(2,3)36-26(34)31-16-11-20(12-17-31)22-19-24(32)30(4)15-7-13-28-14-8-18-35-23-10-6-5-9-21(23)25(33)29-22/h5-6,9-10,20,22,28H,7-8,11-19H2,1-4H3,(H,29,33) |
| InChIKey | VXVCUVWGBXZZDC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |