C30H42N4O4 — CID 175662405
tert-butyl 4-[(16-methyl-17-oxo-8-oxa-12,16,20-triazatricyclo[16.3.1.02,7]docosa-1(22),2,4,6,18,20-hexaen-14-yl)methyl]piperidine-1-carboxylate (PubChem CID 175662405) has the molecular formula C30H42N4O4 and a molecular weight of 522.69 g/mol. Its IUPAC name is tert-butyl 4-[(16-methyl-17-oxo-8-oxa-12,16,20-triazatricyclo[16.3.1.02,7]docosa-1(22),2,4,6,18,20-hexaen-14-yl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(16-methyl-17-oxo-8-oxa-12,16,20-triazatricyclo[16.3.1.02,7]docosa-1(22),2,4,6,18,20-hexaen-14-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175662405 |
| Molecular Formula | C30H42N4O4 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | tert-butyl 4-[(16-methyl-17-oxo-8-oxa-12,16,20-triazatricyclo[16.3.1.02,7]docosa-1(22),2,4,6,18,20-hexaen-14-yl)methyl]piperidine-1-carboxylate |
| SMILES | CN1CC(CC2CCN(C(=O)OC(C)(C)C)CC2)CNCCCOc2ccccc2-c2cncc(c2)C1=O |
| InChI | InChI=1S/C30H42N4O4/c1-30(2,3)38-29(36)34-13-10-22(11-14-34)16-23-18-31-12-7-15-37-27-9-6-5-8-26(27)24-17-25(20-32-19-24)28(35)33(4)21-23/h5-6,8-9,17,19-20,22-23,31H,7,10-16,18,21H2,1-4H3 |
| InChIKey | YHXCWIUYGMAMDS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |