C28H38N4O4 — CID 175661972
tert-butyl 4-(15-methyl-16-oxo-8-oxa-11,15,18-triazatricyclo[15.3.1.02,7]henicosa-1(21),2,4,6,17,19-hexaen-13-yl)piperidine-1-carboxylate (PubChem CID 175661972) has the molecular formula C28H38N4O4 and a molecular weight of 494.64 g/mol. Its IUPAC name is tert-butyl 4-(15-methyl-16-oxo-8-oxa-11,15,18-triazatricyclo[15.3.1.02,7]henicosa-1(21),2,4,6,17,19-hexaen-13-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(15-methyl-16-oxo-8-oxa-11,15,18-triazatricyclo[15.3.1.02,7]henicosa-1(21),2,4,6,17,19-hexaen-13-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175661972 |
| Molecular Formula | C28H38N4O4 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | tert-butyl 4-(15-methyl-16-oxo-8-oxa-11,15,18-triazatricyclo[15.3.1.02,7]henicosa-1(21),2,4,6,17,19-hexaen-13-yl)piperidine-1-carboxylate |
| SMILES | CN1CC(C2CCN(C(=O)OC(C)(C)C)CC2)CNCCOc2ccccc2-c2ccnc(c2)C1=O |
| InChI | InChI=1S/C28H38N4O4/c1-28(2,3)36-27(34)32-14-10-20(11-15-32)22-18-29-13-16-35-25-8-6-5-7-23(25)21-9-12-30-24(17-21)26(33)31(4)19-22/h5-9,12,17,20,22,29H,10-11,13-16,18-19H2,1-4H3 |
| InChIKey | WGOZQBXMLHSKPH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |