C15H11ClN2OS — CID 175663483
2-[(2-chlorophenyl)methylamino]-1,3-benzothiazin-4-one (PubChem CID 175663483) has the molecular formula C15H11ClN2OS and a molecular weight of 302.79 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylamino]-1,3-benzothiazin-4-one.
| Compound Name | 2-[(2-chlorophenyl)methylamino]-1,3-benzothiazin-4-one |
|---|---|
| PubChem CID | 175663483 |
| Molecular Formula | C15H11ClN2OS |
| Molecular Weight | 302.79 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 2-[(2-chlorophenyl)methylamino]-1,3-benzothiazin-4-one |
| SMILES | O=c1nc(NCc2ccccc2Cl)sc2ccccc12 |
| InChI | InChI=1S/C15H11ClN2OS/c16-12-7-3-1-5-10(12)9-17-15-18-14(19)11-6-2-4-8-13(11)20-15/h1-8H,9H2,(H,17,18,19) |
| InChIKey | CYFVYVURCZFHST-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.79 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |