C15H10N2O4S — CID 176514793
3-hydroxy-4-[(4-oxo-1,3-benzothiazin-2-yl)amino]benzoic acid (PubChem CID 176514793) has the molecular formula C15H10N2O4S and a molecular weight of 314.32 g/mol. Its IUPAC name is 3-hydroxy-4-[(4-oxo-1,3-benzothiazin-2-yl)amino]benzoic acid.
| Compound Name | 3-hydroxy-4-[(4-oxo-1,3-benzothiazin-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 176514793 |
| Molecular Formula | C15H10N2O4S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | 3-hydroxy-4-[(4-oxo-1,3-benzothiazin-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nc(=O)c3ccccc3s2)c(O)c1 |
| InChI | InChI=1S/C15H10N2O4S/c18-11-7-8(14(20)21)5-6-10(11)16-15-17-13(19)9-3-1-2-4-12(9)22-15/h1-7,18H,(H,20,21)(H,16,17,19) |
| InChIKey | VYRVJXMZQVXAIR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|