C18H23NO5 — CID 175665193
[(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(3-formyloxyphenyl)-3-hydroxypropanoate (PubChem CID 175665193) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(3-formyloxyphenyl)-3-hydroxypropanoate.
| Compound Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(3-formyloxyphenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 175665193 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | [(1S,5R)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-(3-formyloxyphenyl)-3-hydroxypropanoate |
| SMILES | CN1[C@@H]2CC[C@H]1CC(OC(=O)C(CO)c1cccc(OC=O)c1)C2 |
| InChI | InChI=1S/C18H23NO5/c1-19-13-5-6-14(19)9-16(8-13)24-18(22)17(10-20)12-3-2-4-15(7-12)23-11-21/h2-4,7,11,13-14,16-17,20H,5-6,8-10H2,1H3/t13-,14+,16?,17? |
| InChIKey | LUXKEMUNLQUPLH-CBHXASLJSA-N |
| XLogP | 1.47 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|