C25H36O6Si — CID 175668077
(4S)-5-[4-[[4-(2-ethyl-2-hydroxybutoxy)phenyl]-dimethylsilyl]phenoxy]-4-hydroxypentanoic acid (PubChem CID 175668077) has the molecular formula C25H36O6Si and a molecular weight of 460.64 g/mol. Its IUPAC name is (4S)-5-[4-[[4-(2-ethyl-2-hydroxybutoxy)phenyl]-dimethylsilyl]phenoxy]-4-hydroxypentanoic acid.
| Compound Name | (4S)-5-[4-[[4-(2-ethyl-2-hydroxybutoxy)phenyl]-dimethylsilyl]phenoxy]-4-hydroxypentanoic acid |
|---|---|
| PubChem CID | 175668077 |
| Molecular Formula | C25H36O6Si |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | (4S)-5-[4-[[4-(2-ethyl-2-hydroxybutoxy)phenyl]-dimethylsilyl]phenoxy]-4-hydroxypentanoic acid |
| SMILES | CCC(O)(CC)COc1ccc([Si](C)(C)c2ccc(OC[C@@H](O)CCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H36O6Si/c1-5-25(29,6-2)18-31-21-10-14-23(15-11-21)32(3,4)22-12-8-20(9-13-22)30-17-19(26)7-16-24(27)28/h8-15,19,26,29H,5-7,16-18H2,1-4H3,(H,27,28)/t19-/m0/s1 |
| InChIKey | OWXFCNNGRPVSBM-IBGZPJMESA-N |
| XLogP | 3.04 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|