C31H48O6Si — CID 175668085
(4S)-5-[4-[[4-(2-ethyl-2-hydroxybutoxy)-3-methylphenyl]-dipropylsilyl]-2-methylphenoxy]-4-hydroxypentanoic acid (PubChem CID 175668085) has the molecular formula C31H48O6Si and a molecular weight of 544.81 g/mol. Its IUPAC name is (4S)-5-[4-[[4-(2-ethyl-2-hydroxybutoxy)-3-methylphenyl]-dipropylsilyl]-2-methylphenoxy]-4-hydroxypentanoic acid.
| Compound Name | (4S)-5-[4-[[4-(2-ethyl-2-hydroxybutoxy)-3-methylphenyl]-dipropylsilyl]-2-methylphenoxy]-4-hydroxypentanoic acid |
|---|---|
| PubChem CID | 175668085 |
| Molecular Formula | C31H48O6Si |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | (4S)-5-[4-[[4-(2-ethyl-2-hydroxybutoxy)-3-methylphenyl]-dipropylsilyl]-2-methylphenoxy]-4-hydroxypentanoic acid |
| SMILES | CCC[Si](CCC)(c1ccc(OC[C@@H](O)CCC(=O)O)c(C)c1)c1ccc(OCC(O)(CC)CC)c(C)c1 |
| InChI | InChI=1S/C31H48O6Si/c1-7-17-38(18-8-2,27-13-15-29(24(6)20-27)37-22-31(35,9-3)10-4)26-12-14-28(23(5)19-26)36-21-25(32)11-16-30(33)34/h12-15,19-20,25,32,35H,7-11,16-18,21-22H2,1-6H3,(H,33,34)/t25-/m0/s1 |
| InChIKey | WEFOCDOWLUCQPS-VWLOTQADSA-N |
| XLogP | 5.22 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|