C7H10N3O6P — CID 175673949
2-hydroxy-4-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 175673949) has the molecular formula C7H10N3O6P and a molecular weight of 263.15 g/mol. Its IUPAC name is 2-hydroxy-4-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 2-hydroxy-4-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 175673949 |
| Molecular Formula | C7H10N3O6P |
| Molecular Weight | 263.15 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | 2-hydroxy-4-[(2-methyl-5-nitroimidazol-1-yl)methyl]-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | Cc1ncc([N+](=O)[O-])n1CC1COP(=O)(O)O1 |
| InChI | InChI=1S/C7H10N3O6P/c1-5-8-2-7(10(11)12)9(5)3-6-4-15-17(13,14)16-6/h2,6H,3-4H2,1H3,(H,13,14) |
| InChIKey | SKRNXVXUQHUHOP-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.15 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|