C21H18LiN3O2 — CID 175674044
lithium 1-(1H-indol-3-ylmethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 175674044) has the molecular formula C21H18LiN3O2 and a molecular weight of 351.33 g/mol. Its IUPAC name is lithium 1-(1H-indol-3-ylmethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | lithium 1-(1H-indol-3-ylmethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 175674044 |
| Molecular Formula | C21H18LiN3O2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | lithium 1-(1H-indol-3-ylmethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | O=C([O-])C1Cc2c([nH]c3ccccc23)C(Cc2c[nH]c3ccccc23)N1.[Li+] |
| InChI | InChI=1S/C21H19N3O2.Li/c25-21(26)19-10-15-14-6-2-4-8-17(14)24-20(15)18(23-19)9-12-11-22-16-7-3-1-5-13(12)16;/h1-8,11,18-19,22-24H,9-10H2,(H,25,26);/q;+1/p-1 |
| InChIKey | UAOWSJRQICTUML-UHFFFAOYSA-M |
| XLogP | -0.80 |
| TPSA | 83.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|