C23H33N2O4+ — CID 45101141
tert-butyl 2-[(2S)-2-(1H-indol-3-ylmethyl)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]aziridin-1-ium-1-yl]acetate (PubChem CID 45101141) has the molecular formula C23H33N2O4+ and a molecular weight of 401.53 g/mol. Its IUPAC name is tert-butyl 2-[(2S)-2-(1H-indol-3-ylmethyl)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]aziridin-1-ium-1-yl]acetate.
| Compound Name | tert-butyl 2-[(2S)-2-(1H-indol-3-ylmethyl)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]aziridin-1-ium-1-yl]acetate |
|---|---|
| PubChem CID | 45101141 |
| Molecular Formula | C23H33N2O4+ |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | tert-butyl 2-[(2S)-2-(1H-indol-3-ylmethyl)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]aziridin-1-ium-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[N+]1(CC(=O)OC(C)(C)C)C[C@@H]1Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C23H33N2O4/c1-22(2,3)28-20(26)14-25(15-21(27)29-23(4,5)6)13-17(25)11-16-12-24-19-10-8-7-9-18(16)19/h7-10,12,17,24H,11,13-15H2,1-6H3/q+1/t17-/m0/s1 |
| InChIKey | CTCUKNKWXJENBV-KRWDZBQOSA-N |
| XLogP | 3.59 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|