C22H34BrNO4S — CID 45101065
tert-butyl 2-[(2S)-2-(benzylsulfanylmethyl)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]aziridin-1-ium-1-yl]acetate bromide (PubChem CID 45101065) has the molecular formula C22H34BrNO4S and a molecular weight of 488.49 g/mol. Its IUPAC name is tert-butyl 2-[(2S)-2-(benzylsulfanylmethyl)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]aziridin-1-ium-1-yl]acetate bromide.
| Compound Name | tert-butyl 2-[(2S)-2-(benzylsulfanylmethyl)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]aziridin-1-ium-1-yl]acetate bromide |
|---|---|
| PubChem CID | 45101065 |
| Molecular Formula | C22H34BrNO4S |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | tert-butyl 2-[(2S)-2-(benzylsulfanylmethyl)-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]aziridin-1-ium-1-yl]acetate bromide |
| SMILES | CC(C)(C)OC(=O)C[N+]1(CC(=O)OC(C)(C)C)C[C@H]1CSCc1ccccc1.[Br-] |
| InChI | InChI=1S/C22H34NO4S.BrH/c1-21(2,3)26-19(24)13-23(14-20(25)27-22(4,5)6)12-18(23)16-28-15-17-10-8-7-9-11-17;/h7-11,18H,12-16H2,1-6H3;1H/q+1;/p-1/t18-;/m0./s1 |
| InChIKey | FPYVQDMIEMLVJX-FERBBOLQSA-M |
| XLogP | 0.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|