C19H16Cl2N8O3 — CID 175675341
bis[(1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethyl] carbonate (PubChem CID 175675341) has the molecular formula C19H16Cl2N8O3 and a molecular weight of 475.30 g/mol. Its IUPAC name is bis[(1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethyl] carbonate.
| Compound Name | bis[(1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethyl] carbonate |
|---|---|
| PubChem CID | 175675341 |
| Molecular Formula | C19H16Cl2N8O3 |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | bis[(1R)-1-(2-chlorophenyl)-2-(tetrazol-2-yl)ethyl] carbonate |
| SMILES | O=C(O[C@@H](Cn1ncnn1)c1ccccc1Cl)O[C@@H](Cn1ncnn1)c1ccccc1Cl |
| InChI | InChI=1S/C19H16Cl2N8O3/c20-15-7-3-1-5-13(15)17(9-28-24-11-22-26-28)31-19(30)32-18(10-29-25-12-23-27-29)14-6-2-4-8-16(14)21/h1-8,11-12,17-18H,9-10H2/t17-,18-/m0/s1 |
| InChIKey | WZODLFIPLBODRN-ROUUACIJSA-N |
| XLogP | 3.30 |
| TPSA | 122.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |