C13H15F3N2O12P3+ — CID 175675932
[[hydroperoxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxy-[[(2R,3S,5R)-3-hydroxy-5-[4-(trifluoromethyl)benzimidazol-1-yl]oxolan-2-yl]methoxy]-oxophosphanium (PubChem CID 175675932) has the molecular formula C13H15F3N2O12P3+ and a molecular weight of 541.18 g/mol. Its IUPAC name is [[hydroperoxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxy-[[(2R,3S,5R)-3-hydroxy-5-[4-(trifluoromethyl)benzimidazol-1-yl]oxolan-2-yl]methoxy]-oxophosphanium.
| Compound Name | [[hydroperoxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxy-[[(2R,3S,5R)-3-hydroxy-5-[4-(trifluoromethyl)benzimidazol-1-yl]oxolan-2-yl]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 175675932 |
| Molecular Formula | C13H15F3N2O12P3+ |
| Molecular Weight | 541.18 g/mol |
| Exact Mass | 540.98 |
| IUPAC Name | [[hydroperoxy(hydroxy)phosphoryl]oxy-hydroxyphosphoryl]oxy-[[(2R,3S,5R)-3-hydroxy-5-[4-(trifluoromethyl)benzimidazol-1-yl]oxolan-2-yl]methoxy]-oxophosphanium |
| SMILES | O=[P+](OC[C@H]1O[C@@H](n2cnc3c(C(F)(F)F)cccc32)C[C@@H]1O)OP(=O)(O)OP(=O)(O)OO |
| InChI | InChI=1S/C13H14F3N2O12P3/c14-13(15,16)7-2-1-3-8-12(7)17-6-18(8)11-4-9(19)10(27-11)5-26-31(21)29-33(24,25)30-32(22,23)28-20/h1-3,6,9-11,19H,4-5H2,(H2-,20,22,23,24,25)/p+1/t9-,10+,11+/m0/s1 |
| InChIKey | PVCTXUHTTXJCKO-HBNTYKKESA-O |
| XLogP | 3.10 |
| TPSA | 196.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|