C11H15N3O3S — CID 175676462
4-amino-5-ethenyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2-thione (PubChem CID 175676462) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 4-amino-5-ethenyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2-thione.
| Compound Name | 4-amino-5-ethenyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2-thione |
|---|---|
| PubChem CID | 175676462 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-amino-5-ethenyl-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2-thione |
| SMILES | C=Cc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=S)nc1N |
| InChI | InChI=1S/C11H15N3O3S/c1-2-6-4-14(11(18)13-10(6)12)9-3-7(16)8(5-15)17-9/h2,4,7-9,15-16H,1,3,5H2,(H2,12,13,18)/t7-,8+,9+/m0/s1 |
| InChIKey | IXQNNHVGWMLZCJ-DJLDLDEBSA-N |
| XLogP | 0.48 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|