C30H30N4O10 — CID 175676675
[(2S,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl N-[4-[(9,10-dioxoanthracene-2-carbonyl)amino]butyl]carbamate (PubChem CID 175676675) has the molecular formula C30H30N4O10 and a molecular weight of 606.59 g/mol. Its IUPAC name is [(2S,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl N-[4-[(9,10-dioxoanthracene-2-carbonyl)amino]butyl]carbamate.
| Compound Name | [(2S,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl N-[4-[(9,10-dioxoanthracene-2-carbonyl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 175676675 |
| Molecular Formula | C30H30N4O10 |
| Molecular Weight | 606.59 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | [(2S,4S,5R)-2-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]methyl N-[4-[(9,10-dioxoanthracene-2-carbonyl)amino]butyl]carbamate |
| SMILES | O=C(NCCCCNC(=O)c1ccc2c(c1)C(=O)c1ccccc1C2=O)OC[C@]1(n2ccc(=O)[nH]c2=O)C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C30H30N4O10/c35-15-23-22(36)14-30(44-23,34-12-9-24(37)33-28(34)41)16-43-29(42)32-11-4-3-10-31-27(40)17-7-8-20-21(13-17)26(39)19-6-2-1-5-18(19)25(20)38/h1-2,5-9,12-13,22-23,35-36H,3-4,10-11,14-16H2,(H,31,40)(H,32,42)(H,33,37,41)/t22-,23+,30-/m0/s1 |
| InChIKey | GGFWLWNWVHCXMV-BURCIIJTSA-N |
| XLogP | 0.04 |
| TPSA | 206.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.59 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|