C14H18F2N5O6P — CID 175678053
9-[(4aR,6R,7R,7aR)-4a-(difluoromethyl)-7-hydroxy-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one (PubChem CID 175678053) has the molecular formula C14H18F2N5O6P and a molecular weight of 421.30 g/mol. Its IUPAC name is 9-[(4aR,6R,7R,7aR)-4a-(difluoromethyl)-7-hydroxy-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one.
| Compound Name | 9-[(4aR,6R,7R,7aR)-4a-(difluoromethyl)-7-hydroxy-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one |
|---|---|
| PubChem CID | 175678053 |
| Molecular Formula | C14H18F2N5O6P |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 9-[(4aR,6R,7R,7aR)-4a-(difluoromethyl)-7-hydroxy-2-propan-2-yloxy-4,6,7,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-1H-purin-6-one |
| SMILES | CC(C)OP1OC[C@@]2(C(F)F)O[C@@H](n3cnc4c(=O)[nH]c(N)nc43)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C14H18F2N5O6P/c1-5(2)26-28-24-3-14(12(15)16)8(27-28)7(22)11(25-14)21-4-18-6-9(21)19-13(17)20-10(6)23/h4-5,7-8,11-12,22H,3H2,1-2H3,(H3,17,19,20,23)/t7-,8-,11-,14-,28?/m1/s1 |
| InChIKey | YSIOYRVBMQRQOG-HQCJJDIBSA-N |
| XLogP | 0.66 |
| TPSA | 146.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|