C21H17BrF2N3O4PS — CID 175683141
[[3-bromo-5-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid (PubChem CID 175683141) has the molecular formula C21H17BrF2N3O4PS and a molecular weight of 556.33 g/mol. Its IUPAC name is [[3-bromo-5-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid.
| Compound Name | [[3-bromo-5-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 175683141 |
| Molecular Formula | C21H17BrF2N3O4PS |
| Molecular Weight | 556.33 g/mol |
| Exact Mass | 554.98 |
| IUPAC Name | [[3-bromo-5-[[2-(3,5-dimethylpyrazol-1-yl)phenyl]carbamoyl]-1-benzothiophen-2-yl]-difluoromethyl]phosphonic acid |
| SMILES | Cc1cc(C)n(-c2ccccc2NC(=O)c2ccc3sc(C(F)(F)P(=O)(O)O)c(Br)c3c2)n1 |
| InChI | InChI=1S/C21H17BrF2N3O4PS/c1-11-9-12(2)27(26-11)16-6-4-3-5-15(16)25-20(28)13-7-8-17-14(10-13)18(22)19(33-17)21(23,24)32(29,30)31/h3-10H,1-2H3,(H,25,28)(H2,29,30,31) |
| InChIKey | FXCJJEBGYVDQRL-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.33 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|