C12H19N3O2S — CID 175684385
tert-butyl N-[6-[(dimethyl-λ4-sulfanylidene)amino]-2-pyridinyl]carbamate (PubChem CID 175684385) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is tert-butyl N-[6-[(dimethyl-λ4-sulfanylidene)amino]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[(dimethyl-λ4-sulfanylidene)amino]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 175684385 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | tert-butyl N-[6-[(dimethyl-λ4-sulfanylidene)amino]-2-pyridinyl]carbamate |
| SMILES | CS(C)=Nc1cccc(NC(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C12H19N3O2S/c1-12(2,3)17-11(16)14-9-7-6-8-10(13-9)15-18(4)5/h6-8H,1-5H3,(H,13,14,16) |
| InChIKey | DGLAHWKZKMMQFT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |