C17H21N3O4S — CID 59166177
tert-butyl N-[6-[4-(methylsulfamoyl)phenyl]-2-pyridinyl]carbamate (PubChem CID 59166177) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is tert-butyl N-[6-[4-(methylsulfamoyl)phenyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[4-(methylsulfamoyl)phenyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 59166177 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | tert-butyl N-[6-[4-(methylsulfamoyl)phenyl]-2-pyridinyl]carbamate |
| SMILES | CNS(=O)(=O)c1ccc(-c2cccc(NC(=O)OC(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C17H21N3O4S/c1-17(2,3)24-16(21)20-15-7-5-6-14(19-15)12-8-10-13(11-9-12)25(22,23)18-4/h5-11,18H,1-4H3,(H,19,20,21) |
| InChIKey | SOCFKFXGOIOMTC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |