C11H14N2O4S — CID 175689672
3-(2-methylsulfonylethyl)benzene-1,2-dicarboxamide (PubChem CID 175689672) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is 3-(2-methylsulfonylethyl)benzene-1,2-dicarboxamide.
| Compound Name | 3-(2-methylsulfonylethyl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 175689672 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-(2-methylsulfonylethyl)benzene-1,2-dicarboxamide |
| SMILES | CS(=O)(=O)CCc1cccc(C(N)=O)c1C(N)=O |
| InChI | InChI=1S/C11H14N2O4S/c1-18(16,17)6-5-7-3-2-4-8(10(12)14)9(7)11(13)15/h2-4H,5-6H2,1H3,(H2,12,14)(H2,13,15) |
| InChIKey | RUMGOPSKCXEBTP-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |