C34H36F3N3O2 — CID 175691383
4-[4-(cyclopentylamino)phenyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]-6-oxo-2,3,4,10,12,12a-hexahydro-1H-pyrido[1,2-b][2]benzazepine-3-carboxamide (PubChem CID 175691383) has the molecular formula C34H36F3N3O2 and a molecular weight of 575.68 g/mol. Its IUPAC name is 4-[4-(cyclopentylamino)phenyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]-6-oxo-2,3,4,10,12,12a-hexahydro-1H-pyrido[1,2-b][2]benzazepine-3-carboxamide.
| Compound Name | 4-[4-(cyclopentylamino)phenyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]-6-oxo-2,3,4,10,12,12a-hexahydro-1H-pyrido[1,2-b][2]benzazepine-3-carboxamide |
|---|---|
| PubChem CID | 175691383 |
| Molecular Formula | C34H36F3N3O2 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | 4-[4-(cyclopentylamino)phenyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]-6-oxo-2,3,4,10,12,12a-hexahydro-1H-pyrido[1,2-b][2]benzazepine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCC3CN4CC=CC=C4C(=O)C=C3C2c2ccc(NC3CCCC3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C34H36F3N3O2/c1-21-9-13-26(18-29(21)34(35,36)37)39-33(42)27-16-12-23-20-40-17-5-4-8-30(40)31(41)19-28(23)32(27)22-10-14-25(15-11-22)38-24-6-2-3-7-24/h4-5,8-11,13-15,18-19,23-24,27,32,38H,2-3,6-7,12,16-17,20H2,1H3,(H,39,42) |
| InChIKey | FICRAWKXHKMIQE-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |