C34H36F3N3O2 — CID 174188176
10-[4-(cyclopentylamino)phenyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]-12-oxo-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-b][2]benzazepine-9-carboxamide (PubChem CID 174188176) has the molecular formula C34H36F3N3O2 and a molecular weight of 575.68 g/mol. Its IUPAC name is 10-[4-(cyclopentylamino)phenyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]-12-oxo-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-b][2]benzazepine-9-carboxamide.
| Compound Name | 10-[4-(cyclopentylamino)phenyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]-12-oxo-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-b][2]benzazepine-9-carboxamide |
|---|---|
| PubChem CID | 174188176 |
| Molecular Formula | C34H36F3N3O2 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | 10-[4-(cyclopentylamino)phenyl]-N-[4-methyl-3-(trifluoromethyl)phenyl]-12-oxo-6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-b][2]benzazepine-9-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCC3CCc4ccccc4C(=O)N3C2c2ccc(NC3CCCC3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C34H36F3N3O2/c1-21-10-14-26(20-30(21)34(35,36)37)39-32(41)29-19-18-27-17-13-22-6-2-5-9-28(22)33(42)40(27)31(29)23-11-15-25(16-12-23)38-24-7-3-4-8-24/h2,5-6,9-12,14-16,20,24,27,29,31,38H,3-4,7-8,13,17-19H2,1H3,(H,39,41) |
| InChIKey | KMLCMFYZXQDYMY-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |