C12H12BrFO2 — CID 175691601
4'-bromo-5'-fluorospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] (PubChem CID 175691601) has the molecular formula C12H12BrFO2 and a molecular weight of 287.13 g/mol. Its IUPAC name is 4'-bromo-5'-fluorospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene].
| Compound Name | 4'-bromo-5'-fluorospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] |
|---|---|
| PubChem CID | 175691601 |
| Molecular Formula | C12H12BrFO2 |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 4'-bromo-5'-fluorospiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] |
| SMILES | Fc1cccc2c1C(Br)C1(CC2)OCCO1 |
| InChI | InChI=1S/C12H12BrFO2/c13-11-10-8(2-1-3-9(10)14)4-5-12(11)15-6-7-16-12/h1-3,11H,4-7H2 |
| InChIKey | CDMSSNNUSMZCGV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|