About spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]
spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] (PubChem CID 605322) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene].
Analyze spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]?
The IUPAC name of spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] (CID 605322) is spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene].
What is the SMILES notation for spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]?
The canonical SMILES for spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] is c1ccc2c(c1)CCC1(C2)OCCO1.
What is the InChIKey of spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]?
The InChIKey is APOHLXPINSCOCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O2/c1-2-4-11-9-12(13-7-8-14-12)6-5-10(11)3-1/h1-4H,5-9H2.
What are the key properties of spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene]?
spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] has a molecular weight of 190.24 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] is sourced from PubChem (CID 605322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).