C19H18F6O2 — CID 154708674
7'-(1,1,1,6,6,6-hexafluoro-4-methylhexa-2,3-dien-2-yl)spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] (PubChem CID 154708674) has the molecular formula C19H18F6O2 and a molecular weight of 392.34 g/mol. Its IUPAC name is 7'-(1,1,1,6,6,6-hexafluoro-4-methylhexa-2,3-dien-2-yl)spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene].
| Compound Name | 7'-(1,1,1,6,6,6-hexafluoro-4-methylhexa-2,3-dien-2-yl)spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] |
|---|---|
| PubChem CID | 154708674 |
| Molecular Formula | C19H18F6O2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 7'-(1,1,1,6,6,6-hexafluoro-4-methylhexa-2,3-dien-2-yl)spiro[1,3-dioxolane-2,3'-2,4-dihydro-1H-naphthalene] |
| SMILES | CC(=C=C(c1ccc2c(c1)CCC1(C2)OCCO1)C(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C19H18F6O2/c1-12(10-18(20,21)22)8-16(19(23,24)25)14-2-3-15-11-17(26-6-7-27-17)5-4-13(15)9-14/h2-3,9H,4-7,10-11H2,1H3 |
| InChIKey | GNWJJKDCVLEIKP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |