About 2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one
2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one (PubChem CID 175691752) has the molecular formula C8H5F5N2OS
and a molecular weight of 272.20 g/mol. Its IUPAC name is 2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one |
| PubChem CID | 175691752 |
| Molecular Formula | C8H5F5N2OS |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(S(F)(F)(F)(F)F)nc2ccccc12 |
| InChI | InChI=1S/C8H5F5N2OS/c9-17(10,11,12,13)8-14-6-4-2-1-3-5(6)7(16)15-8/h1-4H,(H,14,15,16) |
| InChIKey | JBNFXRHGLHZHPF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one?
The IUPAC name of 2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one (CID 175691752) is 2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one.
What is the SMILES notation for 2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one?
The canonical SMILES for 2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one is O=c1[nH]c(S(F)(F)(F)(F)F)nc2ccccc12.
What is the InChIKey of 2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one?
The InChIKey is JBNFXRHGLHZHPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F5N2OS/c9-17(10,11,12,13)8-14-6-4-2-1-3-5(6)7(16)15-8/h1-4H,(H,14,15,16).
What are the key properties of 2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one?
2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one has a molecular weight of 272.20 g/mol, XLogP of 3.58, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(pentafluoro-λ6-sulfanyl)-3H-quinazolin-4-one is sourced from PubChem (CID 175691752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).