C23H22N2O7 — CID 175692574
(E)-3-[5-[2-cyano-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]-2-methoxyphenyl]-N-hydroxyprop-2-enamide (PubChem CID 175692574) has the molecular formula C23H22N2O7 and a molecular weight of 438.44 g/mol. Its IUPAC name is (E)-3-[5-[2-cyano-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]-2-methoxyphenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[5-[2-cyano-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]-2-methoxyphenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 175692574 |
| Molecular Formula | C23H22N2O7 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (E)-3-[5-[2-cyano-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]-2-methoxyphenyl]-N-hydroxyprop-2-enamide |
| SMILES | COc1ccc(C=C(C#N)C(=O)c2cc(OC)c(OC)c(OC)c2)cc1/C=C/C(=O)NO |
| InChI | InChI=1S/C23H22N2O7/c1-29-18-7-5-14(9-15(18)6-8-21(26)25-28)10-17(13-24)22(27)16-11-19(30-2)23(32-4)20(12-16)31-3/h5-12,28H,1-4H3,(H,25,26)/b8-6+,17-10? |
| InChIKey | VHTGZQCKJKHNOE-ILLSEFGJSA-N |
| XLogP | 3.03 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|