C22H19F3N2O9 — CID 175546324
N-hydroxy-3-[5-[2-nitro-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]-2-(trifluoromethoxy)phenyl]prop-2-enamide (PubChem CID 175546324) has the molecular formula C22H19F3N2O9 and a molecular weight of 512.39 g/mol. Its IUPAC name is N-hydroxy-3-[5-[2-nitro-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]-2-(trifluoromethoxy)phenyl]prop-2-enamide.
| Compound Name | N-hydroxy-3-[5-[2-nitro-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]-2-(trifluoromethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175546324 |
| Molecular Formula | C22H19F3N2O9 |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | N-hydroxy-3-[5-[2-nitro-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]-2-(trifluoromethoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(C(=O)C(=Cc2ccc(OC(F)(F)F)c(C=CC(=O)NO)c2)[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C22H19F3N2O9/c1-33-17-10-14(11-18(34-2)21(17)35-3)20(29)15(27(31)32)9-12-4-6-16(36-22(23,24)25)13(8-12)5-7-19(28)26-30/h4-11,30H,1-3H3,(H,26,28) |
| InChIKey | MUEMWQBDBKVJNF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 146.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|