C26H29ClN2O3 — CID 175695256
[4-[[6-(4-chlorophenyl)-2-oxaspiro[3.5]non-6-en-7-yl]methyl]piperazin-1-yl] benzoate (PubChem CID 175695256) has the molecular formula C26H29ClN2O3 and a molecular weight of 452.98 g/mol. Its IUPAC name is [4-[[6-(4-chlorophenyl)-2-oxaspiro[3.5]non-6-en-7-yl]methyl]piperazin-1-yl] benzoate.
| Compound Name | [4-[[6-(4-chlorophenyl)-2-oxaspiro[3.5]non-6-en-7-yl]methyl]piperazin-1-yl] benzoate |
|---|---|
| PubChem CID | 175695256 |
| Molecular Formula | C26H29ClN2O3 |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | [4-[[6-(4-chlorophenyl)-2-oxaspiro[3.5]non-6-en-7-yl]methyl]piperazin-1-yl] benzoate |
| SMILES | O=C(ON1CCN(CC2=C(c3ccc(Cl)cc3)CC3(CC2)COC3)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H29ClN2O3/c27-23-8-6-20(7-9-23)24-16-26(18-31-19-26)11-10-22(24)17-28-12-14-29(15-13-28)32-25(30)21-4-2-1-3-5-21/h1-9H,10-19H2 |
| InChIKey | QTGWSAWZPDAJKC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |