C21H15N5O2 — CID 175700533
2-amino-4-[(4-oxo-2-phenylchromen-3-yl)methylamino]pyrimidine-5-carbonitrile (PubChem CID 175700533) has the molecular formula C21H15N5O2 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-amino-4-[(4-oxo-2-phenylchromen-3-yl)methylamino]pyrimidine-5-carbonitrile.
| Compound Name | 2-amino-4-[(4-oxo-2-phenylchromen-3-yl)methylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 175700533 |
| Molecular Formula | C21H15N5O2 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-amino-4-[(4-oxo-2-phenylchromen-3-yl)methylamino]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(N)nc1NCc1c(-c2ccccc2)oc2ccccc2c1=O |
| InChI | InChI=1S/C21H15N5O2/c22-10-14-11-25-21(23)26-20(14)24-12-16-18(27)15-8-4-5-9-17(15)28-19(16)13-6-2-1-3-7-13/h1-9,11H,12H2,(H3,23,24,25,26) |
| InChIKey | NCXSHIAETHJSJP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 117.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |