H3NaO11S4 — CID 175708159
CID 175708159 (PubChem CID 175708159) has the molecular formula H3NaO11S4 and a molecular weight of 330.27 g/mol.
| Compound Name | CID 175708159 |
|---|---|
| PubChem CID | 175708159 |
| Molecular Formula | H3NaO11S4 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.85 |
| IUPAC Name | — |
| SMILES | O=S(=O)([O-])S(=O)(=O)O.O=S(O)S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/Na.H2O6S2.H2O5S2/c;1-7(2,3)8(4,5)6;1-6(2)7(3,4)5/h;(H,1,2,3)(H,4,5,6);(H,1,2)(H,3,4,5)/q+1;;/p-1 |
| InChIKey | AUZHGZZSBGEPPO-UHFFFAOYSA-M |
| XLogP | -5.65 |
| TPSA | 203.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | -5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|