About S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate
S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate (PubChem CID 175715531) has the molecular formula C8H13NO2S
and a molecular weight of 187.26 g/mol. Its IUPAC name is S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate.
Molecular Properties
| Compound Name | S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate |
| PubChem CID | 175715531 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate |
| SMILES | O=C(SC1CCN1)[C@H]1CCCO1 |
| InChI | InChI=1S/C8H13NO2S/c10-8(6-2-1-5-11-6)12-7-3-4-9-7/h6-7,9H,1-5H2/t6-,7?/m1/s1 |
| InChIKey | OUKBEEQVAWUHIA-ULUSZKPHSA-N |
| XLogP | 0.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate?
The IUPAC name of S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate (CID 175715531) is S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate.
What is the SMILES notation for S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate?
The canonical SMILES for S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate is O=C(SC1CCN1)[C@H]1CCCO1.
What is the InChIKey of S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate?
The InChIKey is OUKBEEQVAWUHIA-ULUSZKPHSA-N. The full InChI is InChI=1S/C8H13NO2S/c10-8(6-2-1-5-11-6)12-7-3-4-9-7/h6-7,9H,1-5H2/t6-,7?/m1/s1.
What are the key properties of S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate?
S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate has a molecular weight of 187.26 g/mol, XLogP of 0.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(azetidin-2-yl) (2R)-oxolane-2-carbothioate is sourced from PubChem (CID 175715531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).