C10H9FO — CID 175717219
3,4,5,6-tetradeuterio-2-(1-fluoroethyl)-1-benzofuran (PubChem CID 175717219) has the molecular formula C10H9FO and a molecular weight of 168.20 g/mol. Its IUPAC name is 3,4,5,6-tetradeuterio-2-(1-fluoroethyl)-1-benzofuran.
| Compound Name | 3,4,5,6-tetradeuterio-2-(1-fluoroethyl)-1-benzofuran |
|---|---|
| PubChem CID | 175717219 |
| Molecular Formula | C10H9FO |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 3,4,5,6-tetradeuterio-2-(1-fluoroethyl)-1-benzofuran |
| SMILES | [2H]c1cc2oc(C(C)F)c([2H])c2c([2H])c1[2H] |
| InChI | InChI=1S/C10H9FO/c1-7(11)10-6-8-4-2-3-5-9(8)12-10/h2-7H,1H3/i2D,3D,4D,6D |
| InChIKey | TWBNWHXMELJJOO-UCSNGBFQSA-N |
| XLogP | 3.46 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |