C10H10O2 — CID 175717148
1-(4,6-dideuterio-1-benzofuran-2-yl)ethanol (PubChem CID 175717148) has the molecular formula C10H10O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 1-(4,6-dideuterio-1-benzofuran-2-yl)ethanol.
| Compound Name | 1-(4,6-dideuterio-1-benzofuran-2-yl)ethanol |
|---|---|
| PubChem CID | 175717148 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 1-(4,6-dideuterio-1-benzofuran-2-yl)ethanol |
| SMILES | [2H]c1cc([2H])c2cc(C(C)O)oc2c1 |
| InChI | InChI=1S/C10H10O2/c1-7(11)10-6-8-4-2-3-5-9(8)12-10/h2-7,11H,1H3/i3D,4D |
| InChIKey | SCLFEKBHGKCUPA-NMQOAUCRSA-N |
| XLogP | 2.49 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |